C12H18N2O4S — CID 55008366
ethyl 2-[methyl(2-pyridin-2-ylethylsulfonyl)amino]acetate (PubChem CID 55008366) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is ethyl 2-[methyl(2-pyridin-2-ylethylsulfonyl)amino]acetate.
| Compound Name | ethyl 2-[methyl(2-pyridin-2-ylethylsulfonyl)amino]acetate |
|---|---|
| PubChem CID | 55008366 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | ethyl 2-[methyl(2-pyridin-2-ylethylsulfonyl)amino]acetate |
| SMILES | CCOC(=O)CN(C)S(=O)(=O)CCc1ccccn1 |
| InChI | InChI=1S/C12H18N2O4S/c1-3-18-12(15)10-14(2)19(16,17)9-7-11-6-4-5-8-13-11/h4-6,8H,3,7,9-10H2,1-2H3 |
| InChIKey | RHTCKRTXFBWQHZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |