C12H18N2O4S — CID 28774366
4-[methyl(2-pyridin-2-ylethyl)sulfamoyl]butanoic acid (PubChem CID 28774366) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-[methyl(2-pyridin-2-ylethyl)sulfamoyl]butanoic acid.
| Compound Name | 4-[methyl(2-pyridin-2-ylethyl)sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 28774366 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-[methyl(2-pyridin-2-ylethyl)sulfamoyl]butanoic acid |
| SMILES | CN(CCc1ccccn1)S(=O)(=O)CCCC(=O)O |
| InChI | InChI=1S/C12H18N2O4S/c1-14(9-7-11-5-2-3-8-13-11)19(17,18)10-4-6-12(15)16/h2-3,5,8H,4,6-7,9-10H2,1H3,(H,15,16) |
| InChIKey | FPWONHOJPXCAKS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |