C10H13N3O2S — CID 60677937
1-cyano-N-methyl-N-(2-pyridin-2-ylethyl)methanesulfonamide (PubChem CID 60677937) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 1-cyano-N-methyl-N-(2-pyridin-2-ylethyl)methanesulfonamide.
| Compound Name | 1-cyano-N-methyl-N-(2-pyridin-2-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 60677937 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 1-cyano-N-methyl-N-(2-pyridin-2-ylethyl)methanesulfonamide |
| SMILES | CN(CCc1ccccn1)S(=O)(=O)CC#N |
| InChI | InChI=1S/C10H13N3O2S/c1-13(16(14,15)9-6-11)8-5-10-4-2-3-7-12-10/h2-4,7H,5,8-9H2,1H3 |
| InChIKey | LUTONPWDABPTRM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |