C9H11N3O2S — CID 55208495
1-cyano-N-methyl-N-(pyridin-2-ylmethyl)methanesulfonamide (PubChem CID 55208495) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 1-cyano-N-methyl-N-(pyridin-2-ylmethyl)methanesulfonamide.
| Compound Name | 1-cyano-N-methyl-N-(pyridin-2-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 55208495 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 1-cyano-N-methyl-N-(pyridin-2-ylmethyl)methanesulfonamide |
| SMILES | CN(Cc1ccccn1)S(=O)(=O)CC#N |
| InChI | InChI=1S/C9H11N3O2S/c1-12(15(13,14)7-5-10)8-9-4-2-3-6-11-9/h2-4,6H,7-8H2,1H3 |
| InChIKey | TVFDQZOBGNSQIJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |