C10H17N3O2S — CID 61349685
N-(2-aminoethyl)-N-methyl-2-pyridin-2-ylethanesulfonamide (PubChem CID 61349685) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-methyl-2-pyridin-2-ylethanesulfonamide.
| Compound Name | N-(2-aminoethyl)-N-methyl-2-pyridin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 61349685 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-(2-aminoethyl)-N-methyl-2-pyridin-2-ylethanesulfonamide |
| SMILES | CN(CCN)S(=O)(=O)CCc1ccccn1 |
| InChI | InChI=1S/C10H17N3O2S/c1-13(8-6-11)16(14,15)9-5-10-4-2-3-7-12-10/h2-4,7H,5-6,8-9,11H2,1H3 |
| InChIKey | QNNMJHIQGZWGOG-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |