C15H17BrN2O2S — CID 61067284
N-[(3-bromophenyl)methyl]-N-methyl-2-pyridin-2-ylethanesulfonamide (PubChem CID 61067284) has the molecular formula C15H17BrN2O2S and a molecular weight of 369.28 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N-methyl-2-pyridin-2-ylethanesulfonamide.
| Compound Name | N-[(3-bromophenyl)methyl]-N-methyl-2-pyridin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 61067284 |
| Molecular Formula | C15H17BrN2O2S |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N-methyl-2-pyridin-2-ylethanesulfonamide |
| SMILES | CN(Cc1cccc(Br)c1)S(=O)(=O)CCc1ccccn1 |
| InChI | InChI=1S/C15H17BrN2O2S/c1-18(12-13-5-4-6-14(16)11-13)21(19,20)10-8-15-7-2-3-9-17-15/h2-7,9,11H,8,10,12H2,1H3 |
| InChIKey | ONIUKSGIYUTBAL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |