C14H23ClN2O2S — CID 63400421
N-(2-chloroethyl)-N-pentan-3-yl-2-pyridin-2-ylethanesulfonamide (PubChem CID 63400421) has the molecular formula C14H23ClN2O2S and a molecular weight of 318.87 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-pentan-3-yl-2-pyridin-2-ylethanesulfonamide.
| Compound Name | N-(2-chloroethyl)-N-pentan-3-yl-2-pyridin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 63400421 |
| Molecular Formula | C14H23ClN2O2S |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-(2-chloroethyl)-N-pentan-3-yl-2-pyridin-2-ylethanesulfonamide |
| SMILES | CCC(CC)N(CCCl)S(=O)(=O)CCc1ccccn1 |
| InChI | InChI=1S/C14H23ClN2O2S/c1-3-14(4-2)17(11-9-15)20(18,19)12-8-13-7-5-6-10-16-13/h5-7,10,14H,3-4,8-9,11-12H2,1-2H3 |
| InChIKey | FDHSRYWQYCOVBP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|