C18H20N2O6S — CID 3827562
methyl 2-[(2-ethoxy-2-oxoethyl)-(pyridin-2-ylmethyl)sulfamoyl]benzoate (PubChem CID 3827562) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is methyl 2-[(2-ethoxy-2-oxoethyl)-(pyridin-2-ylmethyl)sulfamoyl]benzoate.
| Compound Name | methyl 2-[(2-ethoxy-2-oxoethyl)-(pyridin-2-ylmethyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 3827562 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | methyl 2-[(2-ethoxy-2-oxoethyl)-(pyridin-2-ylmethyl)sulfamoyl]benzoate |
| SMILES | CCOC(=O)CN(Cc1ccccn1)S(=O)(=O)c1ccccc1C(=O)OC |
| InChI | InChI=1S/C18H20N2O6S/c1-3-26-17(21)13-20(12-14-8-6-7-11-19-14)27(23,24)16-10-5-4-9-15(16)18(22)25-2/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | KTFPIBNBWAQREK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |