C14H21NO5S — CID 79378680
methyl 2-[ethyl-(2-hydroxy-2-methylpropyl)sulfamoyl]benzoate (PubChem CID 79378680) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is methyl 2-[ethyl-(2-hydroxy-2-methylpropyl)sulfamoyl]benzoate.
| Compound Name | methyl 2-[ethyl-(2-hydroxy-2-methylpropyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 79378680 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | methyl 2-[ethyl-(2-hydroxy-2-methylpropyl)sulfamoyl]benzoate |
| SMILES | CCN(CC(C)(C)O)S(=O)(=O)c1ccccc1C(=O)OC |
| InChI | InChI=1S/C14H21NO5S/c1-5-15(10-14(2,3)17)21(18,19)12-9-7-6-8-11(12)13(16)20-4/h6-9,17H,5,10H2,1-4H3 |
| InChIKey | HBMLNXYKEJBRJQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |