C14H15N3S2 — CID 140748007
2-[bis(pyridin-2-ylmethyl)amino]ethanedithioic acid (PubChem CID 140748007) has the molecular formula C14H15N3S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is 2-[bis(pyridin-2-ylmethyl)amino]ethanedithioic acid.
| Compound Name | 2-[bis(pyridin-2-ylmethyl)amino]ethanedithioic acid |
|---|---|
| PubChem CID | 140748007 |
| Molecular Formula | C14H15N3S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-[bis(pyridin-2-ylmethyl)amino]ethanedithioic acid |
| SMILES | S=C(S)CN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C14H15N3S2/c18-14(19)11-17(9-12-5-1-3-7-15-12)10-13-6-2-4-8-16-13/h1-8H,9-11H2,(H,18,19) |
| InChIKey | UVTATOQEBLEWRX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|