C32H29N — CID 144815651
2-[3-[4-(3,5-dimethylphenyl)phenyl]-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]pyridine (PubChem CID 144815651) has the molecular formula C32H29N and a molecular weight of 427.59 g/mol. Its IUPAC name is 2-[3-[4-(3,5-dimethylphenyl)phenyl]-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]pyridine.
| Compound Name | 2-[3-[4-(3,5-dimethylphenyl)phenyl]-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]pyridine |
|---|---|
| PubChem CID | 144815651 |
| Molecular Formula | C32H29N |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 2-[3-[4-(3,5-dimethylphenyl)phenyl]-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]pyridine |
| SMILES | C=C(/C=C\C=C/C)c1cc(-c2ccc(-c3cc(C)cc(C)c3)cc2)cc(-c2ccccn2)c1 |
| InChI | InChI=1S/C32H29N/c1-5-6-7-10-25(4)28-20-30(22-31(21-28)32-11-8-9-16-33-32)27-14-12-26(13-15-27)29-18-23(2)17-24(3)19-29/h5-22H,4H2,1-3H3/b6-5-,10-7- |
| InChIKey | KVFSEBSSOUSHSB-ICZHLNMZSA-N |
| XLogP | 8.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|