C23H32F2 — CID 130178641
2,4-difluoro-1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-(2,2,3-trimethylhept-4-en-3-yl)cyclohexa-1,3-diene (PubChem CID 130178641) has the molecular formula C23H32F2 and a molecular weight of 346.51 g/mol. Its IUPAC name is 2,4-difluoro-1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-(2,2,3-trimethylhept-4-en-3-yl)cyclohexa-1,3-diene.
| Compound Name | 2,4-difluoro-1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-(2,2,3-trimethylhept-4-en-3-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 130178641 |
| Molecular Formula | C23H32F2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2,4-difluoro-1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-(2,2,3-trimethylhept-4-en-3-yl)cyclohexa-1,3-diene |
| SMILES | C=C(/C=C\C=C/C)C1=C(F)C=C(F)CC1C(C)(C=CCC)C(C)(C)C |
| InChI | InChI=1S/C23H32F2/c1-8-10-12-13-17(3)21-19(15-18(24)16-20(21)25)23(7,14-11-9-2)22(4,5)6/h8,10-14,16,19H,3,9,15H2,1-2,4-7H3/b10-8-,13-12-,14-11? |
| InChIKey | VIHOIKTXPSEEJB-XJJWGQEXSA-N |
| XLogP | 7.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|