C17H23NO — CID 137469862
1-[(2S)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2,5-dihydropyrrol-1-yl]-2,2-dimethylbut-3-en-1-one (PubChem CID 137469862) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-[(2S)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2,5-dihydropyrrol-1-yl]-2,2-dimethylbut-3-en-1-one.
| Compound Name | 1-[(2S)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2,5-dihydropyrrol-1-yl]-2,2-dimethylbut-3-en-1-one |
|---|---|
| PubChem CID | 137469862 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 1-[(2S)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2,5-dihydropyrrol-1-yl]-2,2-dimethylbut-3-en-1-one |
| SMILES | C=CC(C)(C)C(=O)N1CC=C[C@H]1C(=C)/C=C\C=C/C |
| InChI | InChI=1S/C17H23NO/c1-6-8-9-11-14(3)15-12-10-13-18(15)16(19)17(4,5)7-2/h6-12,15H,2-3,13H2,1,4-5H3/b8-6-,11-9-/t15-/m0/s1 |
| InChIKey | ZFLAWWURSXMQAE-JOULFREWSA-N |
| XLogP | 3.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|