C11H16O — CID 100937637
(5E,7E)-3,3-dimethylnona-1,5,7-trien-4-one (PubChem CID 100937637) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (5E,7E)-3,3-dimethylnona-1,5,7-trien-4-one.
| Compound Name | (5E,7E)-3,3-dimethylnona-1,5,7-trien-4-one |
|---|---|
| PubChem CID | 100937637 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (5E,7E)-3,3-dimethylnona-1,5,7-trien-4-one |
| SMILES | C=CC(C)(C)C(=O)/C=C/C=C/C |
| InChI | InChI=1S/C11H16O/c1-5-7-8-9-10(12)11(3,4)6-2/h5-9H,2H2,1,3-4H3/b7-5+,9-8+ |
| InChIKey | KQWRKQOWCXEKJF-ZIRGRKGMSA-N |
| XLogP | 2.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|