C14H18O — CID 135157772
(3E,5E,6Z,8Z)-3,5-di(ethylidene)deca-1,6,8-trien-4-one (PubChem CID 135157772) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (3E,5E,6Z,8Z)-3,5-di(ethylidene)deca-1,6,8-trien-4-one.
| Compound Name | (3E,5E,6Z,8Z)-3,5-di(ethylidene)deca-1,6,8-trien-4-one |
|---|---|
| PubChem CID | 135157772 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (3E,5E,6Z,8Z)-3,5-di(ethylidene)deca-1,6,8-trien-4-one |
| SMILES | C=C/C(=C\C)C(=O)C(/C=C\C=C/C)=C/C |
| InChI | InChI=1S/C14H18O/c1-5-9-10-11-13(8-4)14(15)12(6-2)7-3/h5-11H,2H2,1,3-4H3/b9-5-,11-10-,12-7+,13-8+ |
| InChIKey | LXXANFCAWOIRKV-IVUAFFBYSA-N |
| XLogP | 3.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|