C8H10O — CID 85299948
octa-1,4,6-trien-3-one (PubChem CID 85299948) has the molecular formula C8H10O and a molecular weight of 122.17 g/mol. Its IUPAC name is octa-1,4,6-trien-3-one.
| Compound Name | octa-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 85299948 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | octa-1,4,6-trien-3-one |
| SMILES | C=CC(=O)C=CC=CC |
| InChI | InChI=1S/C8H10O/c1-3-5-6-7-8(9)4-2/h3-7H,2H2,1H3 |
| InChIKey | FAURGQQFMLYYKR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|