About (3E,5E)-2-oxohepta-3,5-dienal
(3E,5E)-2-oxohepta-3,5-dienal (PubChem CID 89374999) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is (3E,5E)-2-oxohepta-3,5-dienal.
Molecular Properties
| Compound Name | (3E,5E)-2-oxohepta-3,5-dienal |
| PubChem CID | 89374999 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | (3E,5E)-2-oxohepta-3,5-dienal |
| SMILES | C/C=C/C=C/C(=O)C=O |
| InChI | InChI=1S/C7H8O2/c1-2-3-4-5-7(9)6-8/h2-6H,1H3/b3-2+,5-4+ |
| InChIKey | LKXYVVWLOFXKFZ-MQQKCMAXSA-N |
| XLogP | 0.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-2-oxohepta-3,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-2-oxohepta-3,5-dienal?
The IUPAC name of (3E,5E)-2-oxohepta-3,5-dienal (CID 89374999) is (3E,5E)-2-oxohepta-3,5-dienal.
What is the SMILES notation for (3E,5E)-2-oxohepta-3,5-dienal?
The canonical SMILES for (3E,5E)-2-oxohepta-3,5-dienal is C/C=C/C=C/C(=O)C=O.
What is the InChIKey of (3E,5E)-2-oxohepta-3,5-dienal?
The InChIKey is LKXYVVWLOFXKFZ-MQQKCMAXSA-N. The full InChI is InChI=1S/C7H8O2/c1-2-3-4-5-7(9)6-8/h2-6H,1H3/b3-2+,5-4+.
What are the key properties of (3E,5E)-2-oxohepta-3,5-dienal?
(3E,5E)-2-oxohepta-3,5-dienal has a molecular weight of 124.14 g/mol, XLogP of 0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-2-oxohepta-3,5-dienal is sourced from PubChem (CID 89374999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).