C7H8O2 — CID 89374999
(3E,5E)-2-oxohepta-3,5-dienal (PubChem CID 89374999) has the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. Its IUPAC name is (3E,5E)-2-oxohepta-3,5-dienal.
| Compound Name | (3E,5E)-2-oxohepta-3,5-dienal |
|---|---|
| PubChem CID | 89374999 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | (3E,5E)-2-oxohepta-3,5-dienal |
| SMILES | C/C=C/C=C/C(=O)C=O |
| InChI | InChI=1S/C7H8O2/c1-2-3-4-5-7(9)6-8/h2-6H,1H3/b3-2+,5-4+ |
| InChIKey | LKXYVVWLOFXKFZ-MQQKCMAXSA-N |
| XLogP | 0.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|