C13H20 — CID 123932663
hepta-1,3,5-trien-2-ylcyclohexane (PubChem CID 123932663) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is hepta-1,3,5-trien-2-ylcyclohexane.
| Compound Name | hepta-1,3,5-trien-2-ylcyclohexane |
|---|---|
| PubChem CID | 123932663 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | hepta-1,3,5-trien-2-ylcyclohexane |
| SMILES | C=C(C=CC=CC)C1CCCCC1 |
| InChI | InChI=1S/C13H20/c1-3-4-6-9-12(2)13-10-7-5-8-11-13/h3-4,6,9,13H,2,5,7-8,10-11H2,1H3 |
| InChIKey | VUHQLRKVWFJJSO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|