C11H15F — CID 143627221
[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]cyclopentane (PubChem CID 143627221) has the molecular formula C11H15F and a molecular weight of 166.24 g/mol. Its IUPAC name is [(3Z)-5-fluorohexa-1,3,5-trien-2-yl]cyclopentane.
| Compound Name | [(3Z)-5-fluorohexa-1,3,5-trien-2-yl]cyclopentane |
|---|---|
| PubChem CID | 143627221 |
| Molecular Formula | C11H15F |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | [(3Z)-5-fluorohexa-1,3,5-trien-2-yl]cyclopentane |
| SMILES | C=C(F)/C=C\C(=C)C1CCCC1 |
| InChI | InChI=1S/C11H15F/c1-9(7-8-10(2)12)11-5-3-4-6-11/h7-8,11H,1-6H2/b8-7- |
| InChIKey | QCSRQBIKXKHEBT-FPLPWBNLSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|