C12H19N — CID 145351858
3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]piperidine (PubChem CID 145351858) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]piperidine.
| Compound Name | 3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]piperidine |
|---|---|
| PubChem CID | 145351858 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]piperidine |
| SMILES | C=C(/C=C\C=C/C)C1CCCNC1 |
| InChI | InChI=1S/C12H19N/c1-3-4-5-7-11(2)12-8-6-9-13-10-12/h3-5,7,12-13H,2,6,8-10H2,1H3/b4-3-,7-5- |
| InChIKey | RPXKLHHITKQMIB-MRWCJKGFSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|