C21H26N2O3 — CID 137384851
(Z)-3-(3,4-dimethoxyphenyl)-3-[[(2Z)-4-piperidin-3-ylpenta-2,4-dienylidene]amino]prop-2-enal (PubChem CID 137384851) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is (Z)-3-(3,4-dimethoxyphenyl)-3-[[(2Z)-4-piperidin-3-ylpenta-2,4-dienylidene]amino]prop-2-enal.
| Compound Name | (Z)-3-(3,4-dimethoxyphenyl)-3-[[(2Z)-4-piperidin-3-ylpenta-2,4-dienylidene]amino]prop-2-enal |
|---|---|
| PubChem CID | 137384851 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (Z)-3-(3,4-dimethoxyphenyl)-3-[[(2Z)-4-piperidin-3-ylpenta-2,4-dienylidene]amino]prop-2-enal |
| SMILES | C=C(/C=C\C=N\C(=C/C=O)c1ccc(OC)c(OC)c1)C1CCCNC1 |
| InChI | InChI=1S/C21H26N2O3/c1-16(18-7-5-11-22-15-18)6-4-12-23-19(10-13-24)17-8-9-20(25-2)21(14-17)26-3/h4,6,8-10,12-14,18,22H,1,5,7,11,15H2,2-3H3/b6-4-,19-10-,23-12+ |
| InChIKey | GBPBCIQTWSYRGD-CQEVDQQNSA-N |
| XLogP | 3.43 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|