C22H28N2O3 — CID 137385038
(Z)-3-(3,4-dimethoxyphenyl)-3-[[(2Z)-4-(4-methylpiperidin-1-yl)penta-2,4-dienylidene]amino]prop-2-enal (PubChem CID 137385038) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is (Z)-3-(3,4-dimethoxyphenyl)-3-[[(2Z)-4-(4-methylpiperidin-1-yl)penta-2,4-dienylidene]amino]prop-2-enal.
| Compound Name | (Z)-3-(3,4-dimethoxyphenyl)-3-[[(2Z)-4-(4-methylpiperidin-1-yl)penta-2,4-dienylidene]amino]prop-2-enal |
|---|---|
| PubChem CID | 137385038 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (Z)-3-(3,4-dimethoxyphenyl)-3-[[(2Z)-4-(4-methylpiperidin-1-yl)penta-2,4-dienylidene]amino]prop-2-enal |
| SMILES | C=C(/C=C\C=N\C(=C/C=O)c1ccc(OC)c(OC)c1)N1CCC(C)CC1 |
| InChI | InChI=1S/C22H28N2O3/c1-17-9-13-24(14-10-17)18(2)6-5-12-23-20(11-15-25)19-7-8-21(26-3)22(16-19)27-4/h5-8,11-12,15-17H,2,9-10,13-14H2,1,3-4H3/b6-5-,20-11-,23-12+ |
| InChIKey | IFCVAFPIOPFKFT-KWLDBWTBSA-N |
| XLogP | 4.12 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|