C11H11BrO3 — CID 167435362
(Z)-3-bromo-3-(3,4-dimethoxyphenyl)prop-2-enal (PubChem CID 167435362) has the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. Its IUPAC name is (Z)-3-bromo-3-(3,4-dimethoxyphenyl)prop-2-enal.
| Compound Name | (Z)-3-bromo-3-(3,4-dimethoxyphenyl)prop-2-enal |
|---|---|
| PubChem CID | 167435362 |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | (Z)-3-bromo-3-(3,4-dimethoxyphenyl)prop-2-enal |
| SMILES | COc1ccc(/C(Br)=C/C=O)cc1OC |
| InChI | InChI=1S/C11H11BrO3/c1-14-10-4-3-8(7-11(10)15-2)9(12)5-6-13/h3-7H,1-2H3/b9-5- |
| InChIKey | OPTZGMDQPQYMRL-UITAMQMPSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|