C24H22Br2O3 — CID 102250078
(2E,4E,6E,8E,10E,12E,14E,16Z)-17-bromo-17-(4-bromo-3-methoxyphenyl)heptadeca-2,4,6,8,10,12,14,16-octaenoic acid (PubChem CID 102250078) has the molecular formula C24H22Br2O3 and a molecular weight of 518.25 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E,14E,16Z)-17-bromo-17-(4-bromo-3-methoxyphenyl)heptadeca-2,4,6,8,10,12,14,16-octaenoic acid.
| Compound Name | (2E,4E,6E,8E,10E,12E,14E,16Z)-17-bromo-17-(4-bromo-3-methoxyphenyl)heptadeca-2,4,6,8,10,12,14,16-octaenoic acid |
|---|---|
| PubChem CID | 102250078 |
| Molecular Formula | C24H22Br2O3 |
| Molecular Weight | 518.25 g/mol |
| Exact Mass | 515.99 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14E,16Z)-17-bromo-17-(4-bromo-3-methoxyphenyl)heptadeca-2,4,6,8,10,12,14,16-octaenoic acid |
| SMILES | COc1cc(/C(Br)=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=O)O)ccc1Br |
| InChI | InChI=1S/C24H22Br2O3/c1-29-23-19-20(17-18-22(23)26)21(25)15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-24(27)28/h2-19H,1H3,(H,27,28)/b4-2+,5-3+,8-6+,9-7+,12-10+,13-11+,16-14+,21-15- |
| InChIKey | IFFKAWQPLQNATG-IZHSVLGNSA-N |
| XLogP | 7.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.25 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|