C12H8BrF3O2 — CID 87620055
(2E,4Z)-5-bromo-5-[3-(trifluoromethyl)phenyl]penta-2,4-dienoic acid (PubChem CID 87620055) has the molecular formula C12H8BrF3O2 and a molecular weight of 321.09 g/mol. Its IUPAC name is (2E,4Z)-5-bromo-5-[3-(trifluoromethyl)phenyl]penta-2,4-dienoic acid.
| Compound Name | (2E,4Z)-5-bromo-5-[3-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 87620055 |
| Molecular Formula | C12H8BrF3O2 |
| Molecular Weight | 321.09 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | (2E,4Z)-5-bromo-5-[3-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
| SMILES | O=C(O)/C=C/C=C(\Br)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H8BrF3O2/c13-10(5-2-6-11(17)18)8-3-1-4-9(7-8)12(14,15)16/h1-7H,(H,17,18)/b6-2+,10-5- |
| InChIKey | YCSZVRIRVUDSNG-IPXTUOMSSA-N |
| XLogP | 4.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.09 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|