C12H11BrO2 — CID 173117046
5-bromo-5-(4-methylphenyl)penta-2,4-dienoic acid (PubChem CID 173117046) has the molecular formula C12H11BrO2 and a molecular weight of 267.12 g/mol. Its IUPAC name is 5-bromo-5-(4-methylphenyl)penta-2,4-dienoic acid.
| Compound Name | 5-bromo-5-(4-methylphenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 173117046 |
| Molecular Formula | C12H11BrO2 |
| Molecular Weight | 267.12 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 5-bromo-5-(4-methylphenyl)penta-2,4-dienoic acid |
| SMILES | Cc1ccc(C(Br)=CC=CC(=O)O)cc1 |
| InChI | InChI=1S/C12H11BrO2/c1-9-5-7-10(8-6-9)11(13)3-2-4-12(14)15/h2-8H,1H3,(H,14,15) |
| InChIKey | DCFFBQRPIRUSBV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|