C17H16O2 — CID 116822604
(2E,4E)-5-(6-methylnaphthalen-2-yl)hexa-2,4-dienoic acid (PubChem CID 116822604) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2E,4E)-5-(6-methylnaphthalen-2-yl)hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(6-methylnaphthalen-2-yl)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 116822604 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (2E,4E)-5-(6-methylnaphthalen-2-yl)hexa-2,4-dienoic acid |
| SMILES | C/C(=C\C=C\C(=O)O)c1ccc2cc(C)ccc2c1 |
| InChI | InChI=1S/C17H16O2/c1-12-6-7-16-11-14(8-9-15(16)10-12)13(2)4-3-5-17(18)19/h3-11H,1-2H3,(H,18,19)/b5-3+,13-4+ |
| InChIKey | WOARGTFGVXSUNY-RQPIMZLSSA-N |
| XLogP | 4.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|