C14H14N2O2 — CID 116822570
(2E,4E)-5-(2-methyl-3H-benzimidazol-5-yl)hexa-2,4-dienoic acid (PubChem CID 116822570) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is (2E,4E)-5-(2-methyl-3H-benzimidazol-5-yl)hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(2-methyl-3H-benzimidazol-5-yl)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 116822570 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (2E,4E)-5-(2-methyl-3H-benzimidazol-5-yl)hexa-2,4-dienoic acid |
| SMILES | C/C(=C\C=C\C(=O)O)c1ccc2nc(C)[nH]c2c1 |
| InChI | InChI=1S/C14H14N2O2/c1-9(4-3-5-14(17)18)11-6-7-12-13(8-11)16-10(2)15-12/h3-8H,1-2H3,(H,15,16)(H,17,18)/b5-3+,9-4+ |
| InChIKey | NZOWUHHFODAFCZ-BMVOEDMYSA-N |
| XLogP | 2.92 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|