C10H12N4O — CID 116845661
N,2-dimethyl-3H-benzimidazole-5-carbohydrazide (PubChem CID 116845661) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is N,2-dimethyl-3H-benzimidazole-5-carbohydrazide.
| Compound Name | N,2-dimethyl-3H-benzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 116845661 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | N,2-dimethyl-3H-benzimidazole-5-carbohydrazide |
| SMILES | Cc1nc2ccc(C(=O)N(C)N)cc2[nH]1 |
| InChI | InChI=1S/C10H12N4O/c1-6-12-8-4-3-7(5-9(8)13-6)10(15)14(2)11/h3-5H,11H2,1-2H3,(H,12,13) |
| InChIKey | OLQYMVMCHVULFI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|