C10H8Br2N2O — CID 116827124
2,2-dibromo-1-(2-methyl-3H-benzimidazol-5-yl)ethanone (PubChem CID 116827124) has the molecular formula C10H8Br2N2O and a molecular weight of 332.00 g/mol. Its IUPAC name is 2,2-dibromo-1-(2-methyl-3H-benzimidazol-5-yl)ethanone.
| Compound Name | 2,2-dibromo-1-(2-methyl-3H-benzimidazol-5-yl)ethanone |
|---|---|
| PubChem CID | 116827124 |
| Molecular Formula | C10H8Br2N2O |
| Molecular Weight | 332.00 g/mol |
| Exact Mass | 329.90 |
| IUPAC Name | 2,2-dibromo-1-(2-methyl-3H-benzimidazol-5-yl)ethanone |
| SMILES | Cc1nc2ccc(C(=O)C(Br)Br)cc2[nH]1 |
| InChI | InChI=1S/C10H8Br2N2O/c1-5-13-7-3-2-6(4-8(7)14-5)9(15)10(11)12/h2-4,10H,1H3,(H,13,14) |
| InChIKey | ZVWOXGSBUOGYRR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.00 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|