C14H15FO3 — CID 116822535
(2E,4E)-5-(4-ethoxy-3-fluorophenyl)hexa-2,4-dienoic acid (PubChem CID 116822535) has the molecular formula C14H15FO3 and a molecular weight of 250.27 g/mol. Its IUPAC name is (2E,4E)-5-(4-ethoxy-3-fluorophenyl)hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(4-ethoxy-3-fluorophenyl)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 116822535 |
| Molecular Formula | C14H15FO3 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (2E,4E)-5-(4-ethoxy-3-fluorophenyl)hexa-2,4-dienoic acid |
| SMILES | CCOc1ccc(/C(C)=C/C=C/C(=O)O)cc1F |
| InChI | InChI=1S/C14H15FO3/c1-3-18-13-8-7-11(9-12(13)15)10(2)5-4-6-14(16)17/h4-9H,3H2,1-2H3,(H,16,17)/b6-4+,10-5+ |
| InChIKey | XUYONPFTUBBELU-GQYICFGZSA-N |
| XLogP | 3.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|