C16H14O3 — CID 87598995
(2E,4Z)-5-(furan-2-yl)-5-(4-methylphenyl)penta-2,4-dienoic acid (PubChem CID 87598995) has the molecular formula C16H14O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2E,4Z)-5-(furan-2-yl)-5-(4-methylphenyl)penta-2,4-dienoic acid.
| Compound Name | (2E,4Z)-5-(furan-2-yl)-5-(4-methylphenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 87598995 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (2E,4Z)-5-(furan-2-yl)-5-(4-methylphenyl)penta-2,4-dienoic acid |
| SMILES | Cc1ccc(/C(=C/C=C/C(=O)O)c2ccco2)cc1 |
| InChI | InChI=1S/C16H14O3/c1-12-7-9-13(10-8-12)14(4-2-6-16(17)18)15-5-3-11-19-15/h2-11H,1H3,(H,17,18)/b6-2+,14-4- |
| InChIKey | JGEFQPNMHPSKSE-XVFIWTQTSA-N |
| XLogP | 3.66 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|