C20H14FNO3S2 — CID 54729247
3-fluoro-N-[2-(furan-2-yl)-2-(4-methylphenyl)ethenyl]-6-hydroxythieno[3,2-b]thiophene-5-carboxamide (PubChem CID 54729247) has the molecular formula C20H14FNO3S2 and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-fluoro-N-[2-(furan-2-yl)-2-(4-methylphenyl)ethenyl]-6-hydroxythieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | 3-fluoro-N-[2-(furan-2-yl)-2-(4-methylphenyl)ethenyl]-6-hydroxythieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 54729247 |
| Molecular Formula | C20H14FNO3S2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 3-fluoro-N-[2-(furan-2-yl)-2-(4-methylphenyl)ethenyl]-6-hydroxythieno[3,2-b]thiophene-5-carboxamide |
| SMILES | Cc1ccc(C(=CNC(=O)c2sc3c(F)csc3c2O)c2ccco2)cc1 |
| InChI | InChI=1S/C20H14FNO3S2/c1-11-4-6-12(7-5-11)13(15-3-2-8-25-15)9-22-20(24)19-16(23)18-17(27-19)14(21)10-26-18/h2-10,23H,1H3,(H,22,24) |
| InChIKey | XOKLTNZBWNTJAR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|