C20H15NO3S2 — CID 54736787
N-[2-(furan-2-yl)-2-(4-methylphenyl)ethenyl]-6-hydroxythieno[3,2-b]thiophene-5-carboxamide (PubChem CID 54736787) has the molecular formula C20H15NO3S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-(4-methylphenyl)ethenyl]-6-hydroxythieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-[2-(furan-2-yl)-2-(4-methylphenyl)ethenyl]-6-hydroxythieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 54736787 |
| Molecular Formula | C20H15NO3S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | N-[2-(furan-2-yl)-2-(4-methylphenyl)ethenyl]-6-hydroxythieno[3,2-b]thiophene-5-carboxamide |
| SMILES | Cc1ccc(C(=CNC(=O)c2sc3ccsc3c2O)c2ccco2)cc1 |
| InChI | InChI=1S/C20H15NO3S2/c1-12-4-6-13(7-5-12)14(15-3-2-9-24-15)11-21-20(23)19-17(22)18-16(26-19)8-10-25-18/h2-11,22H,1H3,(H,21,23) |
| InChIKey | VUYGZYAWWCNDEY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|