C10H9ClO4 — CID 141177100
2-(3,4-dimethoxyphenyl)-2-oxoacetyl chloride (PubChem CID 141177100) has the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2-oxoacetyl chloride.
| Compound Name | 2-(3,4-dimethoxyphenyl)-2-oxoacetyl chloride |
|---|---|
| PubChem CID | 141177100 |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.63 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-oxoacetyl chloride |
| SMILES | COc1ccc(C(=O)C(=O)Cl)cc1OC |
| InChI | InChI=1S/C10H9ClO4/c1-14-7-4-3-6(5-8(7)15-2)9(12)10(11)13/h3-5H,1-2H3 |
| InChIKey | CLCXDJXACICRDE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.63 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|