C28H24O10 — CID 172869627
methyl 4-[2-[2-[2-(3,4-dimethoxyphenyl)-2-oxoacetyl]-4,5-dimethoxyphenyl]-2-oxoacetyl]benzoate (PubChem CID 172869627) has the molecular formula C28H24O10 and a molecular weight of 520.49 g/mol. Its IUPAC name is methyl 4-[2-[2-[2-(3,4-dimethoxyphenyl)-2-oxoacetyl]-4,5-dimethoxyphenyl]-2-oxoacetyl]benzoate.
| Compound Name | methyl 4-[2-[2-[2-(3,4-dimethoxyphenyl)-2-oxoacetyl]-4,5-dimethoxyphenyl]-2-oxoacetyl]benzoate |
|---|---|
| PubChem CID | 172869627 |
| Molecular Formula | C28H24O10 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | methyl 4-[2-[2-[2-(3,4-dimethoxyphenyl)-2-oxoacetyl]-4,5-dimethoxyphenyl]-2-oxoacetyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)C(=O)c2cc(OC)c(OC)cc2C(=O)C(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H24O10/c1-34-20-11-10-17(12-21(20)35-2)25(30)27(32)19-14-23(37-4)22(36-3)13-18(19)26(31)24(29)15-6-8-16(9-7-15)28(33)38-5/h6-14H,1-5H3 |
| InChIKey | YGKCYKCLSVBRBI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|