C13H20ClNO3 — CID 159626817
butan-1-amine;3,4-dimethoxybenzoyl chloride (PubChem CID 159626817) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is butan-1-amine;3,4-dimethoxybenzoyl chloride.
| Compound Name | butan-1-amine;3,4-dimethoxybenzoyl chloride |
|---|---|
| PubChem CID | 159626817 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | butan-1-amine;3,4-dimethoxybenzoyl chloride |
| SMILES | CCCCN.COc1ccc(C(=O)Cl)cc1OC |
| InChI | InChI=1S/C9H9ClO3.C4H11N/c1-12-7-4-3-6(9(10)11)5-8(7)13-2;1-2-3-4-5/h3-5H,1-2H3;2-5H2,1H3 |
| InChIKey | MOPHJQMCRDKLFW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|