C13H17NO3 — CID 12523502
(Z)-2-(3,4-dimethoxyphenyl)-3-(dimethylamino)prop-2-enal (PubChem CID 12523502) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is (Z)-2-(3,4-dimethoxyphenyl)-3-(dimethylamino)prop-2-enal.
| Compound Name | (Z)-2-(3,4-dimethoxyphenyl)-3-(dimethylamino)prop-2-enal |
|---|---|
| PubChem CID | 12523502 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (Z)-2-(3,4-dimethoxyphenyl)-3-(dimethylamino)prop-2-enal |
| SMILES | COc1ccc(/C(C=O)=C/N(C)C)cc1OC |
| InChI | InChI=1S/C13H17NO3/c1-14(2)8-11(9-15)10-5-6-12(16-3)13(7-10)17-4/h5-9H,1-4H3/b11-8+ |
| InChIKey | PEUBLRZCVLVRLD-DHZHZOJOSA-N |
| XLogP | 1.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|