C14H16N2O3 — CID 14673985
(E)-2-(3,4-dimethoxybenzoyl)-3-(dimethylamino)prop-2-enenitrile (PubChem CID 14673985) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is (E)-2-(3,4-dimethoxybenzoyl)-3-(dimethylamino)prop-2-enenitrile.
| Compound Name | (E)-2-(3,4-dimethoxybenzoyl)-3-(dimethylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 14673985 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (E)-2-(3,4-dimethoxybenzoyl)-3-(dimethylamino)prop-2-enenitrile |
| SMILES | COc1ccc(C(=O)/C(C#N)=C/N(C)C)cc1OC |
| InChI | InChI=1S/C14H16N2O3/c1-16(2)9-11(8-15)14(17)10-5-6-12(18-3)13(7-10)19-4/h5-7,9H,1-4H3/b11-9+ |
| InChIKey | BVHHTYQYGUMYDD-PKNBQFBNSA-N |
| XLogP | 1.86 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|