C26H29NO6 — CID 25003728
(1E,6E)-1,7-bis(3,4-dimethoxyphenyl)-4-(dimethylaminomethylidene)hepta-1,6-diene-3,5-dione (PubChem CID 25003728) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is (1E,6E)-1,7-bis(3,4-dimethoxyphenyl)-4-(dimethylaminomethylidene)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis(3,4-dimethoxyphenyl)-4-(dimethylaminomethylidene)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 25003728 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | (1E,6E)-1,7-bis(3,4-dimethoxyphenyl)-4-(dimethylaminomethylidene)hepta-1,6-diene-3,5-dione |
| SMILES | COc1ccc(/C=C/C(=O)C(=CN(C)C)C(=O)/C=C/c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C26H29NO6/c1-27(2)17-20(21(28)11-7-18-9-13-23(30-3)25(15-18)32-5)22(29)12-8-19-10-14-24(31-4)26(16-19)33-6/h7-17H,1-6H3/b11-7+,12-8+ |
| InChIKey | WSCCLMHUCNHPSB-MKICQXMISA-N |
| XLogP | 4.03 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|