C18H23NO5 — CID 22596748
4-[2-(3,4-dimethoxybenzoyl)prop-2-enyl]piperidine-1-carboxylic acid (PubChem CID 22596748) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxybenzoyl)prop-2-enyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[2-(3,4-dimethoxybenzoyl)prop-2-enyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22596748 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 4-[2-(3,4-dimethoxybenzoyl)prop-2-enyl]piperidine-1-carboxylic acid |
| SMILES | C=C(CC1CCN(C(=O)O)CC1)C(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H23NO5/c1-12(10-13-6-8-19(9-7-13)18(21)22)17(20)14-4-5-15(23-2)16(11-14)24-3/h4-5,11,13H,1,6-10H2,2-3H3,(H,21,22) |
| InChIKey | MOZXKWTZEYVFLT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|