2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride

C14H20ClNO3 — CID 11000614

IUPAC2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride
SMILESC=C(C[NH+](C)C)C(=O)c1ccc(OC)c(OC)c1.[Cl-]
InChIInChI=1S/C14H19NO3.ClH/c1-10(9-15(2)3)14(16)11-6-7-12(17-4)13(8-11)18-5;/h6-8H,1,9H2,2-5H3;1H
InChIKeyBKAZQBBNNAAARP-UHFFFAOYSA-N
MW285.77 g/mol
LogP-2.41
Rot. Bonds6

About 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride

2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride (PubChem CID 11000614) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride.

Molecular Properties

Compound Name2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride
PubChem CID11000614
Molecular FormulaC14H20ClNO3
Molecular Weight285.77 g/mol
Exact Mass285.11
IUPAC Name2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride
SMILESC=C(C[NH+](C)C)C(=O)c1ccc(OC)c(OC)c1.[Cl-]
InChIInChI=1S/C14H19NO3.ClH/c1-10(9-15(2)3)14(16)11-6-7-12(17-4)13(8-11)18-5;/h6-8H,1,9H2,2-5H3;1H
InChIKeyBKAZQBBNNAAARP-UHFFFAOYSA-N
XLogP-2.41
TPSA39.97 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.77
LogP ≤ 5-2.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride?
The IUPAC name of 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride (CID 11000614) is 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride.
What is the SMILES notation for 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride?
The canonical SMILES for 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride is C=C(C[NH+](C)C)C(=O)c1ccc(OC)c(OC)c1.[Cl-].
What is the InChIKey of 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride?
The InChIKey is BKAZQBBNNAAARP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3.ClH/c1-10(9-15(2)3)14(16)11-6-7-12(17-4)13(8-11)18-5;/h6-8H,1,9H2,2-5H3;1H.
What are the key properties of 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride?
2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride has a molecular weight of 285.77 g/mol, XLogP of -2.41, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride is sourced from PubChem (CID 11000614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).