C14H20ClNO3 — CID 11000614
2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride (PubChem CID 11000614) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride.
| Compound Name | 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 11000614 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-(3,4-dimethoxybenzoyl)prop-2-enyl-dimethylazanium chloride |
| SMILES | C=C(C[NH+](C)C)C(=O)c1ccc(OC)c(OC)c1.[Cl-] |
| InChI | InChI=1S/C14H19NO3.ClH/c1-10(9-15(2)3)14(16)11-6-7-12(17-4)13(8-11)18-5;/h6-8H,1,9H2,2-5H3;1H |
| InChIKey | BKAZQBBNNAAARP-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|