About ethene;piperidine-3-carboxamide
ethene;piperidine-3-carboxamide (PubChem CID 91354072) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is ethene;piperidine-3-carboxamide.
Molecular Properties
| Compound Name | ethene;piperidine-3-carboxamide |
| PubChem CID | 91354072 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | ethene;piperidine-3-carboxamide |
| SMILES | C=C.NC(=O)C1CCCNC1 |
| InChI | InChI=1S/C6H12N2O.C2H4/c7-6(9)5-2-1-3-8-4-5;1-2/h5,8H,1-4H2,(H2,7,9);1-2H2 |
| InChIKey | ASZCLNQPIOINKH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;piperidine-3-carboxamide?
The IUPAC name of ethene;piperidine-3-carboxamide (CID 91354072) is ethene;piperidine-3-carboxamide.
What is the SMILES notation for ethene;piperidine-3-carboxamide?
The canonical SMILES for ethene;piperidine-3-carboxamide is C=C.NC(=O)C1CCCNC1.
What is the InChIKey of ethene;piperidine-3-carboxamide?
The InChIKey is ASZCLNQPIOINKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C2H4/c7-6(9)5-2-1-3-8-4-5;1-2/h5,8H,1-4H2,(H2,7,9);1-2H2.
What are the key properties of ethene;piperidine-3-carboxamide?
ethene;piperidine-3-carboxamide has a molecular weight of 156.23 g/mol, XLogP of 0.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;piperidine-3-carboxamide is sourced from PubChem (CID 91354072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).