About ethane;piperidine-3-carbohydrazide
ethane;piperidine-3-carbohydrazide (PubChem CID 143869941) has the molecular formula C8H19N3O
and a molecular weight of 173.26 g/mol. Its IUPAC name is ethane;piperidine-3-carbohydrazide.
Molecular Properties
| Compound Name | ethane;piperidine-3-carbohydrazide |
| PubChem CID | 143869941 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | ethane;piperidine-3-carbohydrazide |
| SMILES | CC.NNC(=O)C1CCCNC1 |
| InChI | InChI=1S/C6H13N3O.C2H6/c7-9-6(10)5-2-1-3-8-4-5;1-2/h5,8H,1-4,7H2,(H,9,10);1-2H3 |
| InChIKey | CWZDSGNWCSWGBY-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;piperidine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;piperidine-3-carbohydrazide?
The IUPAC name of ethane;piperidine-3-carbohydrazide (CID 143869941) is ethane;piperidine-3-carbohydrazide.
What is the SMILES notation for ethane;piperidine-3-carbohydrazide?
The canonical SMILES for ethane;piperidine-3-carbohydrazide is CC.NNC(=O)C1CCCNC1.
What is the InChIKey of ethane;piperidine-3-carbohydrazide?
The InChIKey is CWZDSGNWCSWGBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O.C2H6/c7-9-6(10)5-2-1-3-8-4-5;1-2/h5,8H,1-4,7H2,(H,9,10);1-2H3.
What are the key properties of ethane;piperidine-3-carbohydrazide?
ethane;piperidine-3-carbohydrazide has a molecular weight of 173.26 g/mol, XLogP of 0.00, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;piperidine-3-carbohydrazide is sourced from PubChem (CID 143869941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).