C11H20N2O3 — CID 81141597
ethyl 3-[[(3R)-piperidine-3-carbonyl]amino]propanoate (PubChem CID 81141597) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is ethyl 3-[[(3R)-piperidine-3-carbonyl]amino]propanoate.
| Compound Name | ethyl 3-[[(3R)-piperidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 81141597 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | ethyl 3-[[(3R)-piperidine-3-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C11H20N2O3/c1-2-16-10(14)5-7-13-11(15)9-4-3-6-12-8-9/h9,12H,2-8H2,1H3,(H,13,15)/t9-/m1/s1 |
| InChIKey | QMRQXAOYURZGGT-SECBINFHSA-N |
| XLogP | 0.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |