C10H21ClN2O3S — CID 119317688
N-(2-ethylsulfonylethyl)piperidine-3-carboxamide;hydrochloride (PubChem CID 119317688) has the molecular formula C10H21ClN2O3S and a molecular weight of 284.81 g/mol. Its IUPAC name is N-(2-ethylsulfonylethyl)piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-ethylsulfonylethyl)piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119317688 |
| Molecular Formula | C10H21ClN2O3S |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-(2-ethylsulfonylethyl)piperidine-3-carboxamide;hydrochloride |
| SMILES | CCS(=O)(=O)CCNC(=O)C1CCCNC1.Cl |
| InChI | InChI=1S/C10H20N2O3S.ClH/c1-2-16(14,15)7-6-12-10(13)9-4-3-5-11-8-9;/h9,11H,2-8H2,1H3,(H,12,13);1H |
| InChIKey | SYWXKLXRVULKSL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |