C12H26ClN3O3S — CID 119292349
N-[3-[ethylsulfonyl(methyl)amino]propyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119292349) has the molecular formula C12H26ClN3O3S and a molecular weight of 327.88 g/mol. Its IUPAC name is N-[3-[ethylsulfonyl(methyl)amino]propyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-[3-[ethylsulfonyl(methyl)amino]propyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119292349 |
| Molecular Formula | C12H26ClN3O3S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-[3-[ethylsulfonyl(methyl)amino]propyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=O)C1CCCNC1.Cl |
| InChI | InChI=1S/C12H25N3O3S.ClH/c1-3-19(17,18)15(2)9-5-8-14-12(16)11-6-4-7-13-10-11;/h11,13H,3-10H2,1-2H3,(H,14,16);1H |
| InChIKey | APDKOOPMJWHARD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|