About azonane-5-carboxamide
azonane-5-carboxamide (PubChem CID 175462100) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is azonane-5-carboxamide.
Molecular Properties
| Compound Name | azonane-5-carboxamide |
| PubChem CID | 175462100 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | azonane-5-carboxamide |
| SMILES | NC(=O)C1CCCCNCCC1 |
| InChI | InChI=1S/C9H18N2O/c10-9(12)8-4-1-2-6-11-7-3-5-8/h8,11H,1-7H2,(H2,10,12) |
| InChIKey | DQNXCVPRXWVTEF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azonane-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azonane-5-carboxamide?
The IUPAC name of azonane-5-carboxamide (CID 175462100) is azonane-5-carboxamide.
What is the SMILES notation for azonane-5-carboxamide?
The canonical SMILES for azonane-5-carboxamide is NC(=O)C1CCCCNCCC1.
What is the InChIKey of azonane-5-carboxamide?
The InChIKey is DQNXCVPRXWVTEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c10-9(12)8-4-1-2-6-11-7-3-5-8/h8,11H,1-7H2,(H2,10,12).
What are the key properties of azonane-5-carboxamide?
azonane-5-carboxamide has a molecular weight of 170.26 g/mol, XLogP of 0.64, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azonane-5-carboxamide is sourced from PubChem (CID 175462100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).