About piperidine-4-carboxamide;trihydrochloride
piperidine-4-carboxamide;trihydrochloride (PubChem CID 141114926) has the molecular formula C6H15Cl3N2O
and a molecular weight of 237.56 g/mol. Its IUPAC name is piperidine-4-carboxamide;trihydrochloride.
Molecular Properties
| Compound Name | piperidine-4-carboxamide;trihydrochloride |
| PubChem CID | 141114926 |
| Molecular Formula | C6H15Cl3N2O |
| Molecular Weight | 237.56 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | piperidine-4-carboxamide;trihydrochloride |
| SMILES | Cl.Cl.Cl.NC(=O)C1CCNCC1 |
| InChI | InChI=1S/C6H12N2O.3ClH/c7-6(9)5-1-3-8-4-2-5;;;/h5,8H,1-4H2,(H2,7,9);3*1H |
| InChIKey | MECMQUIFXPVQKX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.56 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze piperidine-4-carboxamide;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-4-carboxamide;trihydrochloride?
The IUPAC name of piperidine-4-carboxamide;trihydrochloride (CID 141114926) is piperidine-4-carboxamide;trihydrochloride.
What is the SMILES notation for piperidine-4-carboxamide;trihydrochloride?
The canonical SMILES for piperidine-4-carboxamide;trihydrochloride is Cl.Cl.Cl.NC(=O)C1CCNCC1.
What is the InChIKey of piperidine-4-carboxamide;trihydrochloride?
The InChIKey is MECMQUIFXPVQKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.3ClH/c7-6(9)5-1-3-8-4-2-5;;;/h5,8H,1-4H2,(H2,7,9);3*1H.
What are the key properties of piperidine-4-carboxamide;trihydrochloride?
piperidine-4-carboxamide;trihydrochloride has a molecular weight of 237.56 g/mol, XLogP of 0.74, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-4-carboxamide;trihydrochloride is sourced from PubChem (CID 141114926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).