C7H13N3O2 — CID 95970376
(2R,4S)-piperidine-2,4-dicarboxamide (PubChem CID 95970376) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is (2R,4S)-piperidine-2,4-dicarboxamide.
| Compound Name | (2R,4S)-piperidine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 95970376 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (2R,4S)-piperidine-2,4-dicarboxamide |
| SMILES | NC(=O)[C@H]1CCN[C@@H](C(N)=O)C1 |
| InChI | InChI=1S/C7H13N3O2/c8-6(11)4-1-2-10-5(3-4)7(9)12/h4-5,10H,1-3H2,(H2,8,11)(H2,9,12)/t4-,5+/m0/s1 |
| InChIKey | YVALHEFNVSPYNF-CRCLSJGQSA-N |
| XLogP | -1.67 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |